| Compound Information | SONAR Target prediction |
| Name: | CURCUMIN |
| Unique Identifier: | SPE01505345 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C21H20O6 |
| Molecular Weight: | 348.221 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | COc1cc(C=CC(O)=CC(=O)C=Cc2ccc(O)c(OC)c2)ccc1O |
| Class: | aromatic |
| Source: | Curcuma spp |
| Reference: | Ber 51: 1347 (1918); J Pharm Pharmacol 5: 448 (1953); Cancer Res 51:813 (1991) |
| Therapeutics: | antiedemic, antiinflammatory, bile stimulant; antibacterial, antifungal, lipo/cyclooxygenase inhibitor |
| Found: 102 active | as graph: single | with analogs | [1] << Back 91 92 93 94 95 96 97 98 99 100 Next >> [102] |
| Species: | 4932 |
| Condition: | IRE1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.4285±0.0431335 |
| Normalized OD Score: sc h | 0.5736±0.0303812 |
| Z-Score: | -11.6914±0.464703 |
| p-Value: | 3.20458e-30 |
| Z-Factor: | 0.576559 |
| Fitness Defect: | 67.913 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 10748 | Additional Members: 6 | Rows returned: 3 |
| SPE01505140 | 0.43859649122807 |
| SPE01501017 | 0 |
| LAT005C02 | 0 |
Service provided by the
Mike Tyers Laboratory