| Compound Information | SONAR Target prediction |
| Name: | CHLORMADINONE ACETATE |
| Unique Identifier: | SPE01505327 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C23ClH29O4 |
| Molecular Weight: | 375.696 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(Cl)C4=CC(=O)CCC4(C)C3CCC21C)C(C)=O |
| Source: | semisynthetic |
| Reference: | Cancer Metastasis Rev 6:615 (1987); Endocrin J 42:505 (1995) |
| Therapeutics: | progestin, antiandrogen |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [104] |
| Species: | 4932 |
| Condition: | ASF1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6140±0.00671751 |
| Normalized OD Score: sc h | 1.0290±0.0102162 |
| Z-Score: | 1.2165±0.425612 |
| p-Value: | 0.244524 |
| Z-Factor: | -2.57437 |
| Fitness Defect: | 1.4084 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 5652 | Additional Members: 7 | Rows returned: 2 |
| SPE01500381 | 0.526315789473684 |
| Prest1208 | 0 |
Service provided by the
Mike Tyers Laboratory