| Compound Information | SONAR Target prediction |
| Name: | CEPHARANTHINE |
| Unique Identifier: | SPE01505322 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C37H38N2O6 |
| Molecular Weight: | 568.406 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | COc1ccc2CC3N(C)CCc4cc(OC)c(Oc5c6OCOc6cc6CCN(C)C(Cc7ccc(Oc1c2)cc7)c65)c c34 |
| Class: | alkaloid |
| Source: | Stephania spp |
| Reference: | Biochem Pharmacol 46:1887 (1993); Antimicrob Agents Chemother 43:492 (1999) |
| Therapeutics: | antineoplastic, hepatoprotectant, radiopropective |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 81 82 83 84 85 86 87 88 89 90 Next >> [104] |
| Species: | 4932 |
| Condition: | SWR1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6262±0.00304056 |
| Normalized OD Score: sc h | 0.9631±0.00841887 |
| Z-Score: | -1.5185±0.353484 |
| p-Value: | 0.140801 |
| Z-Factor: | -6.41595 |
| Fitness Defect: | 1.9604 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 11120 | Additional Members: 9 | Rows returned: 1 |
| SPE01504185 | 0 |
Service provided by the
Mike Tyers Laboratory