| Compound Information | SONAR Target prediction |
| Name: | SECNIDAZOLE |
| Unique Identifier: | SPE01505304 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C7H11N3O3 |
| Molecular Weight: | 174.093 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | [O-][N+](=O)c1cnc(C)n1CC(C)O |
| Source: | synthetic; PM-185184, RP-14539 |
| Reference: | Drugs 51:621 (1996) |
| Therapeutics: | antiameobic, antitrichomonas |
| Found: 104 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [104] |
| Species: | 4932 |
| Condition: | AAT2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7293±0.0176777 |
| Normalized OD Score: sc h | 0.9943±0.00880184 |
| Z-Score: | -0.2991±0.460586 |
| p-Value: | 0.755454 |
| Z-Factor: | -13.8521 |
| Fitness Defect: | 0.2804 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 6826 | Additional Members: 11 | Rows returned: 1 |
| Prest334 | 0 |
Service provided by the
Mike Tyers Laboratory