| Compound Information | SONAR Target prediction |
| Name: | 3-HYDROXY-3-,4--DIMETHOXYFLAVONE |
| Unique Identifier: | SPE01505278 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C17H14O5 |
| Molecular Weight: | 284.179 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | COc1ccc(cc1OC)C1Oc2ccccc2C(=O)C=1O |
| Class: | flavone |
| Source: | synthetic |
| Reference: | Tetrahedron 32: 565 (1976); Lebensmittelchem Gerichtl.Chem 39: 9 (1985) |
| Found: 19 nonactive | as graph: single | with analogs | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | STO1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5828±0.0377595 |
| Normalized OD Score: sc h | 0.9320±0.0178919 |
| Z-Score: | -2.4135±0.595165 |
| p-Value: | 0.0254422 |
| Z-Factor: | -1.4936 |
| Fitness Defect: | 3.6713 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 10131 | Additional Members: 11 | Rows returned: 2 |
| SPE01505138 | 0.3 |
| SPE01501012 | 0.234042553191489 |
Service provided by the
Mike Tyers Laboratory