Compound Information | SONAR Target prediction | Name: | 6-OXOPROGESTERONE | Unique Identifier: | SPE01505219 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H28O3 | Molecular Weight: | 300.223 g/mol | X log p: | 1.122 (online calculus) | Lipinksi Failures | 0 | TPSA | 51.21 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(=O)C1CCC2C3CC(=O)C4=CC(=O)CCC4(C)C3CCC21C |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.6792±0.0152735 |
Normalized OD Score: sc h |
0.9281±0.00633676 |
Z-Score: |
-1.9409±0.102105 |
p-Value: |
0.0528818 |
Z-Factor: |
-0.407565 |
Fitness Defect: |
2.9397 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 23|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2006-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.039224999999999996±0.00259 | Plate DMSO Control (-): | 0.718075±0.01945 | Plate Z-Factor: | 0.8932 |
| png ps pdf |
101934 |
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro -1H-cyclopenta[a]phenanthrene-3,6-dione |
150986 |
(8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-tr ione |
195096 |
(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
253636 |
(8S,9S,10R,13R,14S,17S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phe nanthrene-3,6-dione |
288203 |
n/a |
585173 |
10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
|