| Compound Information | SONAR Target prediction | | Name: | 6-OXOPROGESTERONE | | Unique Identifier: | SPE01505219 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H28O3 | | Molecular Weight: | 300.223 g/mol | | X log p: | 1.122 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 51.21 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(=O)C1CCC2C3CC(=O)C4=CC(=O)CCC4(C)C3CCC21C |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5515±0.00169706 |
| Normalized OD Score: sc h |
0.9783±0.000843464 |
| Z-Score: |
-0.9563±0.0849742 |
| p-Value: |
0.33978 |
| Z-Factor: |
-23.8036 |
| Fitness Defect: |
1.0795 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|A6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.80 Celcius | | Date: | 2007-09-27 YYYY-MM-DD | | Plate CH Control (+): | 0.040075±0.00050 | | Plate DMSO Control (-): | 0.551875±0.04324 | | Plate Z-Factor: | 0.7289 |
| png ps pdf |
| 101934 |
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro -1H-cyclopenta[a]phenanthrene-3,6-dione |
| 150986 |
(8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,6,17-tr ione |
| 195096 |
(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| 253636 |
(8S,9S,10R,13R,14S,17S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phe nanthrene-3,6-dione |
| 288203 |
n/a |
| 585173 |
10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
|