Compound Information | SONAR Target prediction | Name: | 6-OXOPROGESTERONE | Unique Identifier: | SPE01505219 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H28O3 | Molecular Weight: | 300.223 g/mol | X log p: | 1.122 (online calculus) | Lipinksi Failures | 0 | TPSA | 51.21 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(=O)C1CCC2C3CC(=O)C4=CC(=O)CCC4(C)C3CCC21C |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.3058±0.0333047 |
Normalized OD Score: sc h |
0.7487±0.0416007 |
Z-Score: |
-2.5366±0.0678793 |
p-Value: |
0.011288 |
Z-Factor: |
-0.292531 |
Fitness Defect: |
4.484 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 23|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.30 Celcius | Date: | 2006-02-22 YYYY-MM-DD | Plate CH Control (+): | 0.041175±0.00108 | Plate DMSO Control (-): | 0.380075±0.02354 | Plate Z-Factor: | 0.7378 |
| png ps pdf |
4036085 |
17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
4146610 |
4a,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalene-1,7-dione |
5316741 |
(8S,10R,13R)-17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro -1H-cyclopenta[a]phenanthrene-3,6-dione |
5363650 |
(E)-6,6-dimethyl-9-methylidene-undec-3-ene-2,5,10-trione |
5490007 |
(8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,7,8,9,11,12,14,15,16, 17-decahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
6541170 |
(8S,9R,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phe nanthrene-3,6-dione |
internal high similarity DBLink | Rows returned: 11 | << Back 1 2 |
active | Cluster 2094 | Additional Members: 20 | Rows returned: 7 | << Back 1 2 |
|