| Compound Information | SONAR Target prediction | | Name: | BAEOMYCESIC ACID | | Unique Identifier: | SPE01505218 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 356.198 g/mol | | X log p: | 6.542 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 69.67 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(O)c(C(O)=O)c2C)c(O)c1C=O | | Class: | depside | | Source: | Baeomyces spp. |
| Species: |
4932 |
| Condition: |
SPE01500767 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8646±0.0554372 |
| Normalized OD Score: sc h |
1.0338±0.0177776 |
| Z-Score: |
1.8750±1.18679 |
| p-Value: |
0.15348 |
| Z-Factor: |
-4.63823 |
| Fitness Defect: |
1.8742 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|G10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 22.50 Celcius | | Date: | 2006-11-29 YYYY-MM-DD | | Plate CH Control (+): | 0.041175±0.00221 | | Plate DMSO Control (-): | 0.833±0.02292 | | Plate Z-Factor: | 0.8824 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 6710741 |
5-(3-formyl-2-hydroxy-4-methoxy-6-methyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 | |
|