| Compound Information | SONAR Target prediction | | Name: | BAEOMYCESIC ACID | | Unique Identifier: | SPE01505218 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 356.198 g/mol | | X log p: | 6.542 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 69.67 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(O)c(C(O)=O)c2C)c(O)c1C=O | | Class: | depside | | Source: | Baeomyces spp. |
| Species: |
4932 |
| Condition: |
BY4741-3rd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9200±0.00975807 |
| Normalized OD Score: sc h |
0.9592±0.0151673 |
| Z-Score: |
-2.0182±0.504976 |
| p-Value: |
0.0571176 |
| Z-Factor: |
-3.63882 |
| Fitness Defect: |
2.8626 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 20|E11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09499999999999999±0.00500 | | Plate DMSO Control (-): | 0.9775±0.02835 | | Plate Z-Factor: | 0.8706 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6710741 |
5-(3-formyl-2-hydroxy-4-methoxy-6-methyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 | |
|
