| Compound Information | SONAR Target prediction | | Name: | BAEOMYCESIC ACID | | Unique Identifier: | SPE01505218 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 356.198 g/mol | | X log p: | 6.542 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 69.67 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(O)c(C(O)=O)c2C)c(O)c1C=O | | Class: | depside | | Source: | Baeomyces spp. |
| Species: |
4932 |
| Condition: |
SWR1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6365±0.00516188 |
| Normalized OD Score: sc h |
0.9664±0.0010356 |
| Z-Score: |
-1.3831±0.0499033 |
| p-Value: |
0.166891 |
| Z-Factor: |
-4.056 |
| Fitness Defect: |
1.7904 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 10|F7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.90 Celcius | | Date: | 2008-01-31 YYYY-MM-DD | | Plate CH Control (+): | 0.0411±0.00091 | | Plate DMSO Control (-): | 0.61005±0.02544 | | Plate Z-Factor: | 0.8662 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6710741 |
5-(3-formyl-2-hydroxy-4-methoxy-6-methyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 | |
|
