| Compound Information | SONAR Target prediction |  | Name: | BAEOMYCESIC ACID |  | Unique Identifier: | SPE01505218  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 356.198 g/mol |  | X log p: | 6.542  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 69.67 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(O)c(C(O)=O)c2C)c(O)c1C=O |  | Class: | depside |  | Source: | Baeomyces spp. |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00201539 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5567±0.0136472 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0257±0.0105296 | 
	 
	
		| Z-Score: | 
		0.4250±0.193167 | 
	 
	
		| p-Value: | 
		0.673744 | 
	 
	
		| Z-Factor: | 
		-7.17793 | 
	 
	
		| Fitness Defect: | 
		0.3949 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 2|G10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 22.40 Celcius |  | Date: | 2006-11-29 YYYY-MM-DD |  | Plate CH Control (+): | 0.040275000000000005±0.00150 |  | Plate DMSO Control (-): | 0.554875±0.02088 |  | Plate Z-Factor: | 0.8973 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 6710741 | 
		5-(3-formyl-2-hydroxy-4-methoxy-6-methyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 |  |   
 
 |