Compound Information | SONAR Target prediction | Name: | BAEOMYCESIC ACID | Unique Identifier: | SPE01505218 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 356.198 g/mol | X log p: | 6.542 (online calculus) | Lipinksi Failures | 1 | TPSA | 69.67 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(O)c(C(O)=O)c2C)c(O)c1C=O | Class: | depside | Source: | Baeomyces spp. |
Species: |
4932 |
Condition: |
HHF1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7059±0.0147785 |
Normalized OD Score: sc h |
0.9890±0.0110372 |
Z-Score: |
-0.4847±0.506229 |
p-Value: |
0.649262 |
Z-Factor: |
-63.4539 |
Fitness Defect: |
0.4319 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2008-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.04065±0.00079 | Plate DMSO Control (-): | 0.7063999999999999±0.01693 | Plate Z-Factor: | 0.9197 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6710741 |
5-(3-formyl-2-hydroxy-4-methoxy-6-methyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 | |
|