Compound Information | SONAR Target prediction | Name: | BAEOMYCESIC ACID | Unique Identifier: | SPE01505218 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 356.198 g/mol | X log p: | 6.542 (online calculus) | Lipinksi Failures | 1 | TPSA | 69.67 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | COc1cc(C)c(C(=O)Oc2cc(C)c(O)c(C(O)=O)c2C)c(O)c1C=O | Class: | depside | Source: | Baeomyces spp. |
Species: |
4932 |
Condition: |
SPE01502232 |
Replicates: |
2 |
Raw OD Value: r im |
0.4969±0.0013435 |
Normalized OD Score: sc h |
0.9838±0.00214679 |
Z-Score: |
-0.1814±0.0109615 |
p-Value: |
0.856046 |
Z-Factor: |
-8.66497 |
Fitness Defect: |
0.1554 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|G10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2007-01-19 YYYY-MM-DD | Plate CH Control (+): | 0.26905±0.01342 | Plate DMSO Control (-): | 0.523075±1.71959 | Plate Z-Factor: | 0.7843 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6710741 |
5-(3-formyl-2-hydroxy-4-methoxy-6-methyl-benzoyl)oxy-2-hydroxy-3,6-dimethyl-benzoic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2021 | Additional Members: 2 | Rows returned: 1 | |
|