Compound Information | SONAR Target prediction | Name: | CEFDINIR | Unique Identifier: | SPE01505208 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 382.312 g/mol | X log p: | 2.057 (online calculus) | Lipinksi Failures | 0 | TPSA | 129.77 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | Nc1scc(n1)C(=NO)C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | Source: | semisynthetic; CL-983, FK-482 | Therapeutics: | antibacterial |
Species: |
4932 |
Condition: |
DEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6605±0.0119501 |
Normalized OD Score: sc h |
1.0031±0.00875582 |
Z-Score: |
0.1572±0.40556 |
p-Value: |
0.776984 |
Z-Factor: |
-8.03655 |
Fitness Defect: |
0.2523 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 20|G11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2005-12-22 YYYY-MM-DD | Plate CH Control (+): | 0.040175±0.00477 | Plate DMSO Control (-): | 0.6482749999999999±0.01769 | Plate Z-Factor: | 0.9642 |
| png ps pdf |
11993766 |
(6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azab icyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 437 | Additional Members: 14 | Rows returned: 2 | |
|