Compound Information | SONAR Target prediction | Name: | CEFDINIR | Unique Identifier: | SPE01505208 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 382.312 g/mol | X log p: | 2.057 (online calculus) | Lipinksi Failures | 0 | TPSA | 129.77 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | Nc1scc(n1)C(=NO)C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | Source: | semisynthetic; CL-983, FK-482 | Therapeutics: | antibacterial |
Species: |
4932 |
Condition: |
DCG1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6797±0.00502046 |
Normalized OD Score: sc h |
0.9894±0.004766 |
Z-Score: |
-0.5807±0.255168 |
p-Value: |
0.567762 |
Z-Factor: |
-6.19285 |
Fitness Defect: |
0.5661 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 20|G11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2007-10-25 YYYY-MM-DD | Plate CH Control (+): | 0.040225±0.00131 | Plate DMSO Control (-): | 0.667775±0.01628 | Plate Z-Factor: | 0.9395 |
| png ps pdf |
11993766 |
(6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azab icyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 437 | Additional Members: 14 | Rows returned: 2 | |
|