| Compound Information | SONAR Target prediction | | Name: | CEFDINIR | | Unique Identifier: | SPE01505208 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 382.312 g/mol | | X log p: | 2.057 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 129.77 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Nc1scc(n1)C(=NO)C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | | Source: | semisynthetic; CL-983, FK-482 | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
DBP3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7167±0.00707107 |
| Normalized OD Score: sc h |
0.9894±0.00682686 |
| Z-Score: |
-0.5440±0.333873 |
| p-Value: |
0.596732 |
| Z-Factor: |
-19.4821 |
| Fitness Defect: |
0.5163 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 20|G11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2007-09-13 YYYY-MM-DD | | Plate CH Control (+): | 0.040625±0.00058 | | Plate DMSO Control (-): | 0.7065250000000001±0.01888 | | Plate Z-Factor: | 0.9175 |
|  png
ps
pdf |
| 11993766 |
(6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azab
icyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 437 | Additional Members: 14 | Rows returned: 2 | |
|
