| Compound Information | SONAR Target prediction | | Name: | CEFDINIR | | Unique Identifier: | SPE01505208 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 382.312 g/mol | | X log p: | 2.057 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 129.77 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Nc1scc(n1)C(=NO)C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | | Source: | semisynthetic; CL-983, FK-482 | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
ARF1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6803±0.00770746 |
| Normalized OD Score: sc h |
0.9857±0.00130235 |
| Z-Score: |
-0.6940±0.0653763 |
| p-Value: |
0.488154 |
| Z-Factor: |
-3.25037 |
| Fitness Defect: |
0.7171 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 20|G11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.10 Celcius | | Date: | 2007-10-02 YYYY-MM-DD | | Plate CH Control (+): | 0.0416±0.15068 | | Plate DMSO Control (-): | 0.6799±0.01175 | | Plate Z-Factor: | 0.9447 |
| png ps pdf |
| 11993766 |
(6R,7S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azab icyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 437 | Additional Members: 14 | Rows returned: 2 | |
|