| Compound Information | SONAR Target prediction |
| Name: | ASIATIC ACID |
| Unique Identifier: | SPE01505175 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 440.318 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC1CCC2(CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1C)C(O)=O |
| Class: | triterpene |
| Source: | Dipterocarpus pilosus, Dryobalanops aromatica |
| Reference: | Bull Soc Chim Fr 1959:880; 1961:1586; J Chem Soc 1961:646; Phytochemistry 8:917 (1969) |
| Therapeutics: | wound healing, experimental carcinogen |
| Found: 103 nonactive | as graph: single | with analogs | [1] << Back 51 52 53 54 55 56 57 58 59 60 Next >> [103] |
| Species: | 4932 |
| Condition: | MED2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5781±0.00544472 |
| Normalized OD Score: sc h | 1.0312±0.0111699 |
| Z-Score: | 1.3691±0.516268 |
| p-Value: | 0.199118 |
| Z-Factor: | -2.35587 |
| Fitness Defect: | 1.6139 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 1869 | Additional Members: 9 | Rows returned: 3 |
| SPE00307045 | 0.452380952380952 |
| SPE01505250 | 0.417721518987342 |
| SPE01800031 | 0 |
Service provided by the
Mike Tyers Laboratory