| Compound Information | SONAR Target prediction |
| Name: | ACADESINE |
| Unique Identifier: | SPE01505167 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C9H14N4O5 |
| Molecular Weight: | 244.12 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | NC(=O)c1ncn(C2OC(CO)C(O)C2O)c1N |
| Source: | synthetic |
| Reference: | Eur J Biochem 229:558 (1995)Biochem J 338:783 (1999); J Mol Neurosci 17:45 (2001) |
| Therapeutics: | glucose uptake stimulant; AMPK activator |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 51 52 53 54 55 56 57 58 59 60 Next >> [104] |
| Species: | 4932 |
| Condition: | RBL2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7347±0.00127279 |
| Normalized OD Score: sc h | 1.0381±0.0097839 |
| Z-Score: | 2.1302±0.513759 |
| p-Value: | 0.0449466 |
| Z-Factor: | -0.967011 |
| Fitness Defect: | 3.1023 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 |
| Prest466 | 0.433333333333333 |
| SPE01502238 | 0.423728813559322 |
| SPE01500667 | 0.258620689655172 |
| Prest983 | 0 |
Service provided by the
Mike Tyers Laboratory