| Compound Information | SONAR Target prediction |
| Name: | ALENDRONATE SODIUM |
| Unique Identifier: | SPE01505166 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C4H13NO7P2 |
| Molecular Weight: | 235.993 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | NCCCC(O)(P(O)(O)=O)P(O)(O)=O |
| Source: | synthesis |
| Reference: | Nature 223:211 (1969); Cancer Res 62:2708 (2002); Mol Pharmacol 62:1255 (2002) |
| Therapeutics: | bone resorption inhibitor, farnesyldiphosphate synthetase inhibitor, antimetastatic |
| Found: 103 nonactive | as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [103] |
| Species: | 4932 |
| Condition: | BY4741 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7575±0.000919239 |
| Normalized OD Score: sc h | 0.9341±0.00150139 |
| Z-Score: | -1.4254±0.110803 |
| p-Value: | 0.155298 |
| Z-Factor: | -1.15968 |
| Fitness Defect: | 1.8624 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 404 | Additional Members: 1 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory