| Compound Information | SONAR Target prediction |
| Name: | ERIODYCTOL |
| Unique Identifier: | SPE01505145 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H12O6 |
| Molecular Weight: | 276.157 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Oc1cc(O)c2C(=O)CC(Oc2c1)c1ccc(O)c(O)c1 |
| Class: | flavan |
| Source: | common flavan in numerous plant families |
| Reference: | J Chem Soc 91:895 (1907); 97:2054 (1910) |
| Therapeutics: | expectorant |
| Found: 91 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [91] |
| Species: | 4932 |
| Condition: | BCK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7085±0.00551543 |
| Normalized OD Score: sc h | 0.9998±0.00973258 |
| Z-Score: | -0.0066±0.49433 |
| p-Value: | 0.726686 |
| Z-Factor: | -14.4925 |
| Fitness Defect: | 0.3193 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 14672 | Additional Members: 12 | Rows returned: 1 |
| SPE01504154 | 0.416666666666667 |
Service provided by the
Mike Tyers Laboratory