| Compound Information | SONAR Target prediction |
| Name: | GOSSYPETIN |
| Unique Identifier: | SPE01505143 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H10O8 |
| Molecular Weight: | 308.156 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Oc1ccc(cc1O)C1Oc2c(O)c(O)cc(O)c2C(=O)C=1O |
| Class: | flavone |
| Source: | widespread in plants |
| Reference: | J Chem Soc 1929:24 |
| Found: 102 nonactive | as graph: single | with analogs | [1] << Back 61 62 63 64 65 66 67 68 69 70 Next >> [102] |
| Species: | 4932 |
| Condition: | RBL2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7169±0.00190919 |
| Normalized OD Score: sc h | 1.0048±0.00181794 |
| Z-Score: | 0.2665±0.096391 |
| p-Value: | 0.7903 |
| Z-Factor: | -5.64234 |
| Fitness Defect: | 0.2353 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 10732 | Additional Members: 22 | Rows returned: 7 | 1 2 Next >> |
| RJC 00213 | 0.508196721311475 |
| SPE01502259 | 0.421052631578947 |
| Prest342 | 0.326923076923077 |
| LOPAC 01061 | 0.326923076923077 |
| Prest1133 | 0.224489795918367 |
| Prest541 | 0 |
Service provided by the
Mike Tyers Laboratory