| Compound Information | SONAR Target prediction |
| Name: | 3-,4--DIHYDROXYFLAVONE |
| Unique Identifier: | SPE01505139 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 244.158 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | Oc1ccc(cc1O)C1Oc2ccccc2C(=O)C=1 |
| Class: | flavone |
| Source: | Primula officinalis (glucoside) |
| Reference: | Ber 38:2177 (1905); Phytochemistry 7:1215 (1968) |
| Found: 89 nonactive | as graph: single | with analogs | [1] << Back 71 72 73 74 75 76 77 78 79 80 Next >> [89] |
| Species: | 4932 |
| Condition: | STO1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6194±0.0184555 |
| Normalized OD Score: sc h | 0.9914±0.0051481 |
| Z-Score: | -0.3096±0.187921 |
| p-Value: | 0.758908 |
| Z-Factor: | -27.0283 |
| Fitness Defect: | 0.2759 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 12019 | Additional Members: 25 | Rows returned: 7 | 1 2 Next >> |
| SPE01504132 | 0.480769230769231 |
| LAT006E05 | 0.403846153846154 |
| LOPAC 01174 | 0.403846153846154 |
| BTB 13702 | 0.347826086956522 |
| SPE01500735 | 0.326530612244898 |
| SPE01500741 | 0.295454545454545 |
Service provided by the
Mike Tyers Laboratory