| Compound Information | SONAR Target prediction |
| Name: | ALCLOMETAZONE DIPROPIONATE |
| Unique Identifier: | SPE01505125 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C28ClH37O7 |
| Molecular Weight: | 483.748 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CCC(=O)OCC(=O)C1(OC(=O)CC)C(C)CC2C3C(Cl)CC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| Source: | semisynthetic; SCH-22219 |
| Therapeutics: | antiinflammatory, glucocorticoid |
| Found: 91 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [91] |
| Species: | 4932 |
| Condition: | ARL3 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6991±0.00749533 |
| Normalized OD Score: sc h | 1.0357±0.0102622 |
| Z-Score: | 1.6751±0.427294 |
| p-Value: | 0.108888 |
| Z-Factor: | -1.74365 |
| Fitness Defect: | 2.2174 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 17014 | Additional Members: 17 | Rows returned: 2 |
| Prest1079 | 0.577319587628866 |
| Prest840 | 0.425287356321839 |
Service provided by the
Mike Tyers Laboratory