| Compound Information | SONAR Target prediction |
| Name: | 21-ACETOXYPREGNENOLONE |
| Unique Identifier: | SPE01505123 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C23H34O4 |
| Molecular Weight: | 340.244 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(=O)OCC(=O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| Class: | sterol |
| Source: | semisynthetic |
| Reference: | PNAS 94:4895 (1997) |
| Therapeutics: | precursor in corticoid biosynthesis, derivative |
| Found: 67 nonactive | as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [67] |
| Species: | 4932 |
| Condition: | DOC1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.4897±0.0178898 |
| Normalized OD Score: sc h | 0.9268±0.0383606 |
| Z-Score: | -2.5573±1.25705 |
| p-Value: | 0.0478998 |
| Z-Factor: | -2.59698 |
| Fitness Defect: | 3.0386 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 |
| SPE00270029 | 0.405797101449275 |
| SPE01500645 | 0.276923076923077 |
| SPE01505713 | 0.205882352941177 |
Service provided by the
Mike Tyers Laboratory