| Compound Information | SONAR Target prediction |
| Name: | 11a-ACETOXYPROGESTERONE |
| Unique Identifier: | SPE01505121 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C23H32O4 |
| Molecular Weight: | 340.244 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(=O)OC1CC2(C)C(CCC2C(C)=O)C2CCC3=CC(=O)CCC3(C)C12 |
| Class: | sterol |
| Source: | semisynthetic |
| Reference: | Endocrinology 53:221 (1953); Biochem Biophys Res Commun 319:677 (2004) |
| Therapeutics: | metabolite of progesterone |
| Found: 104 nonactive as graph: single | with analogs | [1] << Back 71 72 73 74 75 76 77 78 79 80 Next >> [104] |
| Species: | 4932 |
| Condition: | RBL2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7118±0.0033234 |
| Normalized OD Score: sc h | 1.0039±0.012086 |
| Z-Score: | 0.2125±0.673424 |
| p-Value: | 0.641526 |
| Z-Factor: | -10.2207 |
| Fitness Defect: | 0.4439 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 2094 | Additional Members: 20 | Rows returned: 7 | 1 2 Next >> |
| SPE00300034 | 0.375 |
| SPE00307023 | 0.348484848484849 |
| SPE00300029 | 0.285714285714286 |
| SPE01500508 | 0 |
| LAT002C06 | 0 |
| LAT005F10 | 0 |
Service provided by the
Mike Tyers Laboratory