| Compound Information | SONAR Target prediction |
| Name: | 11a-ACETOXYPROGESTERONE |
| Unique Identifier: | SPE01505121 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C23H32O4 |
| Molecular Weight: | 340.244 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC(=O)OC1CC2(C)C(CCC2C(C)=O)C2CCC3=CC(=O)CCC3(C)C12 |
| Class: | sterol |
| Source: | semisynthetic |
| Reference: | Endocrinology 53:221 (1953); Biochem Biophys Res Commun 319:677 (2004) |
| Therapeutics: | metabolite of progesterone |
| Found: 104 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [104] |
| Species: | 4932 |
| Condition: | BCK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6535±0.0026163 |
| Normalized OD Score: sc h | 1.0064±0.00393912 |
| Z-Score: | 0.7983±0.180945 |
| p-Value: | 0.428502 |
| Z-Factor: | -3.65749 |
| Fitness Defect: | 0.8475 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 2094 | Additional Members: 20 | Rows returned: 7 | << Back 1 2 |
| LOPAC 01120 | 0 |
Service provided by the
Mike Tyers Laboratory