| Compound Information | SONAR Target prediction |
| Name: | PIZOTYLINE MALATE |
| Unique Identifier: | SPE01505003 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C23H27NO5S |
| Molecular Weight: | 402.316 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CN1CCC(CC1)=C1c2ccsc2CCc2ccccc21.OC(CC(O)=O)C(O)=O |
| Source: | synthetic; PIZOTIFEN; BC-105 |
| Reference: | J Cardiovas Pharmacol 8:805 (1986); Eur Neurol 38:31 (1997) |
| Therapeutics: | 5HT antagonist, antimigraine |
| Found: 103 nonactive | as graph: single | with analogs | [1] << Back 91 92 93 94 95 96 97 98 99 100 Next >> [103] |
| Species: | 4932 |
| Condition: | NPR1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.9631±0.0891662 |
| Normalized OD Score: sc h | 0.9698±0.0430529 |
| Z-Score: | 0.4828±1.13032 |
| p-Value: | 0.475742 |
| Z-Factor: | -7.85174 |
| Fitness Defect: | 0.7429 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4311 | Additional Members: 10 | Rows returned: 1 |
| SPE01501114 | 0.571428571428571 |
Service provided by the
Mike Tyers Laboratory