| Compound Information | SONAR Target prediction |
| Name: | NEORUSCOGENIN |
| Unique Identifier: | SPE01504607 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C27H40O4 |
| Molecular Weight: | 388.286 g/mol |
| X log p: | (online calculus) |
| Lipinksi Failures | |
| TPSA | |
| Hydrogen Bond Donor Count: | |
| Hydrogen Bond Acceptors Count: | |
| Rotatable Bond Count: | |
| Canonical Smiles: | CC1C2C(CC3C4CC=C5CC(O)CC(O)C5(C)C4CCC32C)OC21CCC(=C)CO2 |
| Class: | sterol |
| Source: | Ruscus spp, Sansevieria trifasciata |
| Reference: | Fitoterapia 42:127 (1971); Tetrahedron 28:1289 (1972) |
| Therapeutics: | antiinflammatory |
| Found: 81 nonactive | as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [81] |
| Species: | 4932 |
| Condition: | DCC1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6626±0.025173 |
| Normalized OD Score: sc h | 0.9794±0.0245792 |
| Z-Score: | -0.9336±1.1041 |
| p-Value: | 0.482468 |
| Z-Factor: | -7.49941 |
| Fitness Defect: | 0.7288 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 10789 | Additional Members: 6 | Rows returned: 2 |
| Prest1042 | 0 |
| SPE00100537 | 0 |
Service provided by the
Mike Tyers Laboratory