| Compound Information | SONAR Target prediction | | Name: | ROSIGLITAZONE | | Unique Identifier: | SPE01504263 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 338.277 g/mol | | X log p: | 17.026 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 84.27 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)c1ccccn1 | | Source: | synthetic | | Therapeutics: | antidiabetic |
| Species: |
4932 |
| Condition: |
RGP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3314±0.0108187 |
| Normalized OD Score: sc h |
0.7573±0.0229351 |
| Z-Score: |
-6.3422±0.684264 |
| p-Value: |
0.0000000023422 |
| Z-Factor: |
0.314337 |
| Fitness Defect: |
19.8722 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 5|G3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.10 Celcius | | Date: | 2008-06-26 YYYY-MM-DD | | Plate CH Control (+): | 0.04±0.00048 | | Plate DMSO Control (-): | 0.4274±0.01390 | | Plate Z-Factor: | 0.8823 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 77999 |
5-[[4-[2-(methyl-pyridin-2-yl-amino)ethoxy]phenyl]methyl]thiazolidine-2,4-dione |
| 445655 |
(5S)-5-[[4-[2-(methyl-pyridin-2-yl-amino)ethoxy]phenyl]methyl]thiazolidine-2,4-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7138 | Additional Members: 4 | Rows returned: 0 | |
|
