| Compound Information | SONAR Target prediction | | Name: | SIMVASTATIN | | Unique Identifier: | SPE01504236 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 380.264 g/mol | | X log p: | 5.565 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C12 | | Source: | synthetic | | Therapeutics: | antihyperlipidemic, HMGCoA reductase inhibitor | | Generic_name: | Simvastatin | | Chemical_iupac_name: | [8-[2-(4-hydroxy-6-oxo-tetrahydropyran-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahyd ronaphthalen-1-yl]2,2-dimethylbutanoate | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA451363 | | Kegg_compound_id: | D00434 | | Drugbank_id: | APRD00104 | | Melting_point: | 135-138oC | | H2o_solubility: | 0.76 mg/L | | Logp: | 4.937 | | Cas_registry_number: | 79902-63-9 | | Drug_category: | Antilipemic Agents; Anticholesteremic Agents; HMG-CoA Reductase Inhibitors; ATC:C10AA01 | | Indication: | For the treatment of hypercholesterolemia. | | Pharmacology: | Simvastatin, the methylated form of lovastatin, is an oral antilipemic agent which inhibits HMG-CoA reductase. simvastatin is used in the treatment of primary hypercholesterolemia and is effective in reducing total and LDL-cholesterol as well as plasma triglycerides and apolipoprotein B. | | Mechanism_of_action: | The 6-membered lactone ring of simvastatin is hydrolyzed in vivo to generate mevinolinic acid, an active metabolite structurally similar to HMG-CoA (hydroxymethylglutaryl CoA). Once hydrolyzed, simvastatin competes with HMG-CoA for HMG-CoA reductase, a hepatic microsomal enzyme. Interference with the activity of this enzyme reduces the quantity of mevalonic acid, a precursor of cholesterol. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
CHS3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5515±0.0226981 |
| Normalized OD Score: sc h |
0.8411±0.0245269 |
| Z-Score: |
-7.3405±0.960044 |
| p-Value: |
0.0000000000135375 |
| Z-Factor: |
0.119955 |
| Fitness Defect: |
25.0256 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 3|C9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.00 Celcius | | Date: | 2008-06-20 YYYY-MM-DD | | Plate CH Control (+): | 0.040125±0.00047 | | Plate DMSO Control (-): | 0.650575±0.01396 | | Plate Z-Factor: | 0.9403 |
| png ps pdf |
| 6604877 |
[(1S,7R,8S,8aR)-8-[2-[(2R,4S)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen -1-yl] (2S)-2-methylbutanoate |
| 6713163 |
[(1R,7R,8R,8aS)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen -1-yl] (2R)-2-methylbutanoate |
| 6956366 |
[(1R,3S,7S,8R,8aS)-8-[2-[(2S,4S)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronap hthalen-1-yl] 2,2-dimethylbutanoate |
| 6978793 |
[(1S,3S,7R,8R,8aR)-8-[2-[(2S,4S)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronap hthalen-1-yl] 2,2-dimethylbutanoate |
| 7048516 |
[(1S,3R,7R,8S,8aS)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronap hthalen-1-yl] 2,2-dimethylbutanoate |
| 7048568 |
[(1S,3R,7R,8S,8aS)-8-[2-[(2R,4R)-4-hydroxy-6-oxo-oxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronap hthalen-1-yl] (2S)-2-methylbutanoate |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 2780 | Additional Members: 9 | Rows returned: 5 | |
|