| Compound Information | SONAR Target prediction | | Name: | 18-AMINOABIETA-8,11,13-TRIENE SULFATE | | Unique Identifier: | SPE01504234 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 350.284 g/mol | | X log p: | 6.382 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CN)CCCC32C)c1.OS(O)(=O)=O | | Class: | diterpene | | Source: | derivative of abietic acid |
| Species: |
4932 |
| Condition: |
CLN2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5253±0.00657609 |
| Normalized OD Score: sc h |
0.8035±0.00475528 |
| Z-Score: |
-8.8178±0.660798 |
| p-Value: |
3.39716e-17 |
| Z-Factor: |
-8.02236 |
| Fitness Defect: |
37.921 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 22|A2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.90 Celcius | | Date: | 2007-11-16 YYYY-MM-DD | | Plate CH Control (+): | 0.0427±0.00110 | | Plate DMSO Control (-): | 0.6475500000000001±0.18209 | | Plate Z-Factor: | -0.0690 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 410304 |
(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine; sulfuric acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|