Compound Information | SONAR Target prediction | Name: | 18-AMINOABIETA-8,11,13-TRIENE SULFATE | Unique Identifier: | SPE01504234 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 350.284 g/mol | X log p: | 6.382 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CN)CCCC32C)c1.OS(O)(=O)=O | Class: | diterpene | Source: | derivative of abietic acid |
Species: |
4932 |
Condition: |
BIK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4374±0.0100409 |
Normalized OD Score: sc h |
0.6519±0.0129784 |
Z-Score: |
-15.2567±0.69103 |
p-Value: |
0 |
Z-Factor: |
-1.90047 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 22|A2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.40 Celcius | Date: | 2007-11-08 YYYY-MM-DD | Plate CH Control (+): | 0.040624999999999994±0.00025 | Plate DMSO Control (-): | 0.660175±0.16546 | Plate Z-Factor: | 0.1287 |
| png ps pdf |
DBLink | Rows returned: 1 | |
410304 |
(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine; sulfuric acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|