Compound Information | SONAR Target prediction | Name: | 18-AMINOABIETA-8,11,13-TRIENE SULFATE | Unique Identifier: | SPE01504234 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 350.284 g/mol | X log p: | 6.382 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CN)CCCC32C)c1.OS(O)(=O)=O | Class: | diterpene | Source: | derivative of abietic acid |
Species: |
4932 |
Condition: |
FKS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5353±0.00473762 |
Normalized OD Score: sc h |
0.5521±0.0101813 |
Z-Score: |
-14.0522±1.82743 |
p-Value: |
1.37125e-37 |
Z-Factor: |
0.772716 |
Fitness Defect: |
84.8799 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.50 Celcius | Date: | 2008-06-04 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00065 | Plate DMSO Control (-): | 0.626525±0.01149 | Plate Z-Factor: | 0.9297 |
| png ps pdf |
DBLink | Rows returned: 1 | |
410304 |
(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine; sulfuric acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|