Compound Information | SONAR Target prediction | Name: | 18-AMINOABIETA-8,11,13-TRIENE SULFATE | Unique Identifier: | SPE01504234 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 350.284 g/mol | X log p: | 6.382 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CN)CCCC32C)c1.OS(O)(=O)=O | Class: | diterpene | Source: | derivative of abietic acid |
Species: |
4932 |
Condition: |
TRK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4508±0.00629325 |
Normalized OD Score: sc h |
0.9543±0.0111079 |
Z-Score: |
-1.4133±0.338804 |
p-Value: |
0.169442 |
Z-Factor: |
-2.65542 |
Fitness Defect: |
1.7752 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2008-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.0405±0.00114 | Plate DMSO Control (-): | 0.46135000000000004±0.02062 | Plate Z-Factor: | 0.8447 |
| png ps pdf |
DBLink | Rows returned: 1 | |
410304 |
(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methanamine; sulfuric acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|