| 
 | Compound Information | SONAR Target prediction |  | Name: | CLARITHROMYCIN |  | Unique Identifier: | SPE01504231 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C38H69NO13 |  | Molecular Weight: | 678.406 g/mol |  | X log p: | -2.127  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 101.99 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 14 |  | Rotatable Bond Count: | 8 |  | Canonical Smiles: | CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC(C2O)N(C)C)C(C) (CC(C)C(=O)C(C)C(O)C1(C)O)OC
 |  | Therapeutics: | antibiotic |  | Generic_name: | Clarithromycin |  | Chemical_iupac_name: | 6-(4-dimethylamino-3-hydroxy-6-methyl-tetrahydropyran-2-yl)oxy-14-ethyl-12,13-dihydr oxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-tetrahydropyran-2-yl)oxy-7-methoxy-3,5,7,9,1
 1,13-hexamethyl-1-oxacyclotetradecane-2,10-dione
 |  | Drug_type: | Approved Drug |  | Kegg_compound_id: | C06912 |  | Drugbank_id: | APRD00181 |  | Melting_point: | 217 - 220 oC |  | H2o_solubility: | 0.33 mg/L |  | Logp: | 2.69 |  | Isoelectric_point: | 8.99 |  | Cas_registry_number: | 81103-11-9 |  | Drug_category: | Anti-bacterial Agents; Other Macrolides; ATC:J01FA09 |  | Indication: | For the treatment of Bacterial infection of (Pharyngitis/Tonsillitis, sinusitis, bronchitis, Pneumonia, Uncomplicated skin and skin structure infections ) caused by
 H.influenzae, M.catarrhalis, M.pneumoniae, S.pneumoniae, C.pneumoniae (TWAR),
 S.aureus, S. pyogenes, Mycobacterium avium and Mycobacterium intracellulare
 |  | Pharmacology: | Clarithromycin, a macrolide antibiotic similar to erythromycin and azithromycin, is effective against Mycobacterium avium complex (MAC) and is used for the treatment of
 Helicobacter pylori-associated peptic ulcer disease, community-acquired
 pneumonia, sinusitis, and chronic bronchitis. Clarithromycin is also used to treat
 respiratory tract, sexually transmitted, otitis media, and AIDS-related infections.
 |  | Mechanism_of_action: | Clarithromycin is first metabolized to 14-OH clarithromycin. Like other macrolides, it then binds to the 50 S subunit of the 70 S ribosome of the bacteria, blocking
 RNA-mediated bacterial protein synthesis. Clarithromycin also inhibits the hepatic
 microsomal CYP3A4 isoenzyme and P-glycoprotein, an energy-dependent drug efflux
 pump.
 |  | Organisms_affected: | Enteric bacteria and other eubacteria | 
 
 
	
		| Species: | 4932 |  
		| Condition: | NUP100 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7280±0.0252437 |  
		| Normalized OD Score: sc h | 0.9823±0.00235943 |  
		| Z-Score: | -1.2063±0.151928 |  
		| p-Value: | 0.230366 |  
		| Z-Factor: | -60.1475 |  
		| Fitness Defect: | 1.4681 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 21|D6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.60 Celcius |  | Date: | 2007-08-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.041275±0.00376 |  | Plate DMSO Control (-): | 0.7173±0.13789 |  | Plate Z-Factor: | 0.3340 | 
 |  png ps
 pdf
 | 
 
 
	
		| 2778 | 6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-12,13-dihydroxy-4-(5-hydroxy-4-methoxy-6-methyl-oxan -2-yl)oxy-7-methoxy-3,7,9,11,13,14-hexamethyl-1-oxacyclotetradecane-2,10-dione
 |  
		| 31864 | (3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-4-[(2S,4R,5S,6S)-4,5-dihydroxy-4,6-dimethyl-oxan-2-yl]oxy-6-[(2S,3R, 4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-7-[(2S,4R,5R,6S)-4-dimethylamino-5-hydroxy-6-met
 hyl-oxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecane-2,10-dione
 |  
		| 54688 | (3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-14-ethyl-12,13-d ihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl)oxy-7-methoxy-3,5,7,9,11,13-hexamethyl-1-oxacyclo
 tetradecane-2,10-dione
 |  
		| 73657 | (3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-4-[(2S,4R,5S,6S)-4,5-dihydroxy-4,6-dimethyl-oxan-2-yl]oxy-6-[(2S,3R, 4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-7-[(2S,4R,6S)-4-dimethylamino-5-hydroxy-6-methyl
 -oxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecane-2,10-dione
 |  
		| 84020 | (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-12 ,13-dihydroxy-14-(1-hydroxyethyl)-4-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-7-meth
 oxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecane-2,10-dione
 |  
		| 84029 | (3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-6-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-14 -ethyl-12,13-dihydroxy-4-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-7-methoxy-3,5,7,9
 ,11,13-hexamethyl-1-oxacyclotetradecane-2,10-dione
 |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 14145 | Additional Members: 11 | Rows returned: 1 |  | 
 
 |