| Compound Information | SONAR Target prediction | | Name: | CLARITHROMYCIN | | Unique Identifier: | SPE01504231 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C38H69NO13 | | Molecular Weight: | 678.406 g/mol | | X log p: | -2.127 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 101.99 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 14 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC(C2O)N(C)C)C(C) (CC(C)C(=O)C(C)C(O)C1(C)O)OC | | Therapeutics: | antibiotic | | Generic_name: | Clarithromycin | | Chemical_iupac_name: | 6-(4-dimethylamino-3-hydroxy-6-methyl-tetrahydropyran-2-yl)oxy-14-ethyl-12,13-dihydr oxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-tetrahydropyran-2-yl)oxy-7-methoxy-3,5,7,9,1 1,13-hexamethyl-1-oxacyclotetradecane-2,10-dione | | Drug_type: | Approved Drug | | Kegg_compound_id: | C06912 | | Drugbank_id: | APRD00181 | | Melting_point: | 217 - 220 oC | | H2o_solubility: | 0.33 mg/L | | Logp: | 2.69 | | Isoelectric_point: | 8.99 | | Cas_registry_number: | 81103-11-9 | | Drug_category: | Anti-bacterial Agents; Other Macrolides; ATC:J01FA09 | | Indication: | For the treatment of Bacterial infection of (Pharyngitis/Tonsillitis, sinusitis, bronchitis, Pneumonia, Uncomplicated skin and skin structure infections ) caused by H.influenzae, M.catarrhalis, M.pneumoniae, S.pneumoniae, C.pneumoniae (TWAR), S.aureus, S. pyogenes, Mycobacterium avium and Mycobacterium intracellulare | | Pharmacology: | Clarithromycin, a macrolide antibiotic similar to erythromycin and azithromycin, is effective against Mycobacterium avium complex (MAC) and is used for the treatment of Helicobacter pylori-associated peptic ulcer disease, community-acquired pneumonia, sinusitis, and chronic bronchitis. Clarithromycin is also used to treat respiratory tract, sexually transmitted, otitis media, and AIDS-related infections. | | Mechanism_of_action: | Clarithromycin is first metabolized to 14-OH clarithromycin. Like other macrolides, it then binds to the 50 S subunit of the 70 S ribosome of the bacteria, blocking RNA-mediated bacterial protein synthesis. Clarithromycin also inhibits the hepatic microsomal CYP3A4 isoenzyme and P-glycoprotein, an energy-dependent drug efflux pump. | | Organisms_affected: | Enteric bacteria and other eubacteria |
| Species: |
4932 |
| Condition: |
RIC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5524±0.00714178 |
| Normalized OD Score: sc h |
0.9958±0.00139107 |
| Z-Score: |
-0.0899±0.0166564 |
| p-Value: |
0.928346 |
| Z-Factor: |
-132.42 |
| Fitness Defect: |
0.0744 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 21|D6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2006-03-18 YYYY-MM-DD | | Plate CH Control (+): | 0.039075±0.00138 | | Plate DMSO Control (-): | 0.5078±0.02631 | | Plate Z-Factor: | 0.7829 |
| png ps pdf |
| 3086467 |
[(2S,3S,4R,6S)-6-[[(3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-6-[(2R,3S,4R,6S)-4-dimethylamino-3-hydroxy-6-meth yl-oxan-2-yl]oxy-7-[(2S,4R,5R,6S)-4-dimethylamino-5-hydroxy-6-methyl-oxan-2-yl]oxy-14-ethyl-12,13-dihydr oxy-3,5,7,9,11,13-hexamethyl-2,10-dioxo-1-oxacyclotetradec-4-yl]oxy]-3-hydroxy-2,4-dimethyl-oxan-4-yl] acetate |
| 4663848 |
6-(4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl)oxy-14-ethyl-12,13-dihydroxy-4-(5-hydroxy-4-methoxy-4,6- dimethyl-oxan-2-yl)oxy-7-methoxy-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecane-2,10-dione |
| 5284534 |
(3R,4S,6R,7R,9R,11R,12R,13R,14R)-6-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-14-et hyl-12,13-dihydroxy-4-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-7-methoxy-3,5,7,9,11 ,13-hexamethyl-1-oxacyclotetradecane-2,10-dione |
| 5311050 |
(3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-6-[(3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-14-et hyl-12,13-dihydroxy-4-[(4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl]oxy-7-methoxy-3,5,7,9,11,13 -hexamethyl-1-oxacyclotetradecane-2,10-dione |
| 6426662 |
(3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-6-[(2S,4R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-14-ethyl -12,13-dihydroxy-4-(5-hydroxy-4-methoxy-4,6-dimethyl-oxan-2-yl)oxy-7-methoxy-3,5,7,9,11,13-hexamethyl-1- oxacyclotetradecane-2,10-dione |
| 15950098 |
(3R,4R,5R,6R,7S,9R,11S,12R,13S,14S)-14-ethyl-12,13-dihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-di methyl-oxan-2-yl]oxy-6-[(2S,3R,4S,6R)-3-hydroxy-6-methyl-4-methylamino-oxan-2-yl]oxy-7-methoxy-3,5,7,9,1 1,13-hexamethyl-1-oxacyclotetradecane-2,10-dione |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 14145 | Additional Members: 11 | Rows returned: 1 | |
|