| Compound Information | SONAR Target prediction |
| Name: | N,N-HEXAMETHYLENEAMILORIDE |
| Unique Identifier: | SPE01504215 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C12ClH18N7O |
| Molecular Weight: | 293.628 g/mol |
| X log p: | -1.366 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 45.03 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 8 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | NC(=N)NC(=O)c1nc(Cl)c(nc1N)N1CCCCCC1 |
| Reference: | Biochim Biophys Acta 944: 383 (1988) |
| Therapeutics: | Na/H+ antiporter inhibitor, diuretic |
| Found: 113 nonactive | as graph: single | with analogs | [1] << Back 51 52 53 54 55 56 57 58 59 60 Next >> [113] |
| Species: | 4932 |
| Condition: | MRT4 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5762±0.0598212 |
| Normalized OD Score: sc h | 0.9990±0.00600169 |
| Z-Score: | -0.0491±0.204394 |
| p-Value: | 0.88522 |
| Z-Factor: | -15.7729 |
| Fitness Defect: | 0.1219 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4060 | Additional Members: 8 | Rows returned: 1 |
| SPE01500112 | 0 |
Service provided by the
Mike Tyers Laboratory