Compound Information | SONAR Target prediction | Name: | PRISTIMEROL | Unique Identifier: | SPE01504207 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H42O4 | Molecular Weight: | 424.319 g/mol | X log p: | 4.738 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | COC(=O)C1(C)CCC2(C)CCC3(C)C4=CCc5c(C)c(O)c(O)cc5C4(C)CCC3(C)C2C1 | Source: | derivative of pristimerin |
Species: |
4932 |
Condition: |
NUM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7092±0.00714178 |
Normalized OD Score: sc h |
0.9931±0.0097225 |
Z-Score: |
-0.3047±0.427957 |
p-Value: |
0.770974 |
Z-Factor: |
-20.4297 |
Fitness Defect: |
0.2601 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 8|G3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.70 Celcius | Date: | 2006-02-10 YYYY-MM-DD | Plate CH Control (+): | 0.039925±0.00119 | Plate DMSO Control (-): | 0.6932±0.01368 | Plate Z-Factor: | 0.9203 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6708798 |
methyl (2R,4aR,6aS,6aR,14aS)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picen e-2-carboxylate |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 3682 | Additional Members: 3 | Rows returned: 1 | |
|