| Compound Information | SONAR Target prediction | | Name: | PRISTIMEROL | | Unique Identifier: | SPE01504207 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H42O4 | | Molecular Weight: | 424.319 g/mol | | X log p: | 4.738 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | COC(=O)C1(C)CCC2(C)CCC3(C)C4=CCc5c(C)c(O)c(O)cc5C4(C)CCC3(C)C2C1 | | Source: | derivative of pristimerin |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6225±0.0250316 |
| Normalized OD Score: sc h |
0.9579±0.000194979 |
| Z-Score: |
-0.8224±0.0183529 |
| p-Value: |
0.410904 |
| Z-Factor: |
-0.38592 |
| Fitness Defect: |
0.8894 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|G3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2006-03-24 YYYY-MM-DD | | Plate CH Control (+): | 0.0387±0.00260 | | Plate DMSO Control (-): | 0.657775±0.01089 | | Plate Z-Factor: | 0.9119 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6708798 |
methyl
(2R,4aR,6aS,6aR,14aS)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picen
e-2-carboxylate |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 3682 | Additional Members: 3 | Rows returned: 1 | |
|
