| Compound Information | SONAR Target prediction | | Name: | PRISTIMEROL | | Unique Identifier: | SPE01504207 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H42O4 | | Molecular Weight: | 424.319 g/mol | | X log p: | 4.738 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | COC(=O)C1(C)CCC2(C)CCC3(C)C4=CCc5c(C)c(O)c(O)cc5C4(C)CCC3(C)C2C1 | | Source: | derivative of pristimerin |
| Species: |
4932 |
| Condition: |
CLN2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6425±0.00268701 |
| Normalized OD Score: sc h |
0.9679±0.00636055 |
| Z-Score: |
-1.4331±0.212036 |
| p-Value: |
0.156411 |
| Z-Factor: |
-2.32708 |
| Fitness Defect: |
1.8553 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|G3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.20 Celcius | | Date: | 2007-11-16 YYYY-MM-DD | | Plate CH Control (+): | 0.041675000000000004±0.00059 | | Plate DMSO Control (-): | 0.648825±0.01973 | | Plate Z-Factor: | 0.9001 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 6708798 |
methyl (2R,4aR,6aS,6aR,14aS)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picen e-2-carboxylate |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 3682 | Additional Members: 3 | Rows returned: 1 | |
|