| Compound Information | SONAR Target prediction |
| Name: | PEUCEDANIN |
| Unique Identifier: | SPE01504168 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H14O4 |
| Molecular Weight: | 244.158 g/mol |
| X log p: | 9.136 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 44.76 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | COc1c(oc2cc3OC(=O)C=Cc3cc21)C(C)C |
| Source: | ex Peucedanum spp |
| Reference: | Indian J Chem 2: 464 (1964) |
| Found: 451 nonactive | as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [451] |
| Species: | 4932 |
| Condition: | SPE01504180 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7425±0.0191626 |
| Normalized OD Score: sc h | 0.9748±0.004022 |
| Z-Score: | -1.4674±0.0888153 |
| p-Value: | 0.143066 |
| Z-Factor: | -2.72143 |
| Fitness Defect: | 1.9444 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 8616 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 14605 | Additional Members: 7 | Rows returned: 1 |
| SPE00100101 | 0.491228070175439 |
Service provided by the
Mike Tyers Laboratory