| Compound Information | SONAR Target prediction |  | Name: | PINOCEMBRIN |  | Unique Identifier: | SPE01504154  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C15H12O4 |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 14.716  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1cc(O)c2C(=O)CC(Oc2c1)c1ccccc1 |  | Source: | ex Pinus, Prunus, Eucalyptus spp |  | Reference: | Acta Chem Scand 5: 1, 121, 129 (1951); Chem Nat Comp 1: 111 (1986) |  | Therapeutics: | antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		IDH2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5643±0.00240416 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9676±0.00151772 | 
	 
	
		| Z-Score: | 
		-1.6224±0.115717 | 
	 
	
		| p-Value: | 
		0.105879 | 
	 
	
		| Z-Factor: | 
		-0.741464 | 
	 
	
		| Fitness Defect: | 
		2.2455 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|A6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.70 Celcius |  | Date: | 2007-10-19 YYYY-MM-DD |  | Plate CH Control (+): | 0.04085±0.00058 |  | Plate DMSO Control (-): | 0.57315±0.01012 |  | Plate Z-Factor: | 0.9390 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 68071 | 
		(2S)-5,7-dihydroxy-2-phenyl-chroman-4-one | 
	 
	
		| 238782 | 
		5,7-dihydroxy-2-phenyl-chroman-4-one | 
	 
	
		| 667544 | 
		(2R)-5,7-dihydroxy-2-phenyl-chroman-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 15 | 1 2 3 Next >>  |   
 |  active | Cluster 14672 | Additional Members: 12 | Rows returned: 0 |  |  
  
 |