| 
 | Compound Information | SONAR Target prediction |  | Name: | PINOCEMBRIN |  | Unique Identifier: | SPE01504154 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C15H12O4 |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 14.716  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1cc(O)c2C(=O)CC(Oc2c1)c1ccccc1 |  | Source: | ex Pinus, Prunus, Eucalyptus spp |  | Reference: | Acta Chem Scand 5: 1, 121, 129 (1951); Chem Nat Comp 1: 111 (1986) |  | Therapeutics: | antiinflammatory | 
 
 
	
		| Species: | 4932 |  
		| Condition: | GCN5 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.1521±0.0101116 |  
		| Normalized OD Score: sc h | 0.5954±0.0108575 |  
		| Z-Score: | -6.9342±0.138628 |  
		| p-Value: | 0.00000000000508346 |  
		| Z-Factor: | 0.296682 |  
		| Fitness Defect: | 26.005 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|A6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.30 Celcius |  | Date: | 2007-10-30 YYYY-MM-DD |  | Plate CH Control (+): | 0.041175±0.00059 |  | Plate DMSO Control (-): | 0.255025±0.02158 |  | Plate Z-Factor: | 0.7016 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 68071 | (2S)-5,7-dihydroxy-2-phenyl-chroman-4-one |  
		| 238782 | 5,7-dihydroxy-2-phenyl-chroman-4-one |  
		| 667544 | (2R)-5,7-dihydroxy-2-phenyl-chroman-4-one |  
 
 | active | Cluster 14672 | Additional Members: 12 | Rows returned: 0 |  | 
 
 |