| Compound Information | SONAR Target prediction | | Name: | MELOXICAM SODIUM | | Unique Identifier: | SPE01504150 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 338.3 g/mol | | X log p: | 10.452 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 100.49 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CN1C(C(=O)Nc2sc(C)cn2)=C(O)c2ccccc2S1(=O)=O | | Source: | synthetic | | Reference: | Neuropharmacol 39: 1653 (2000) | | Therapeutics: | antiinflammatory |
| Species: |
4932 |
| Condition: |
HSC82 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7158±0.00509117 |
| Normalized OD Score: sc h |
0.9644±0.000282031 |
| Z-Score: |
-1.9881±0.134754 |
| p-Value: |
0.0477982 |
| Z-Factor: |
-0.276341 |
| Fitness Defect: |
3.0408 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 20|F7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.30 Celcius | | Date: | 2008-04-29 YYYY-MM-DD | | Plate CH Control (+): | 0.040675±0.00112 | | Plate DMSO Control (-): | 0.7156499999999999±0.01140 | | Plate Z-Factor: | 0.9398 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 4051 |
sodium 9-methyl-8-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]-10,10-dioxo-10$l^{6}-thia-9-azabicyclo[4.4.0]deca-1,3, 5,7-tetraen-7-olate |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 16469 | Additional Members: 9 | Rows returned: 4 | |
|