| Compound Information | SONAR Target prediction |  | Name: | MELOXICAM SODIUM |  | Unique Identifier: | SPE01504150  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 338.3 g/mol |  | X log p: | 10.452  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 100.49 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CN1C(C(=O)Nc2sc(C)cn2)=C(O)c2ccccc2S1(=O)=O |  | Source: | synthetic |  | Reference: | Neuropharmacol 39: 1653 (2000) |  | Therapeutics: | antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		VPS1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6472±0.00714178 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9845±0.00677303 | 
	 
	
		| Z-Score: | 
		-0.6102±0.248405 | 
	 
	
		| p-Value: | 
		0.547946 | 
	 
	
		| Z-Factor: | 
		-6.49445 | 
	 
	
		| Fitness Defect: | 
		0.6016 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 21|F8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.10 Celcius |  | Date: | 2007-10-03 YYYY-MM-DD |  | Plate CH Control (+): | 0.040525±0.00068 |  | Plate DMSO Control (-): | 0.64±0.19674 |  | Plate Z-Factor: | -0.1931 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 4051 | 
		sodium 9-methyl-8-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]-10,10-dioxo-10$l^{6}-thia-9-azabicyclo[4.4.0]deca-1,3, 5,7-tetraen-7-olate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 16469 | Additional Members: 9 | Rows returned: 4 |  |   
 
 |