Compound Information | SONAR Target prediction | Name: | ARACHIDONIC ACID | Unique Identifier: | SPE01504138 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 272.213 g/mol | X log p: | 15.756 (online calculus) | Lipinksi Failures | 2 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 14 | Canonical Smiles: | CCCCCC=CCC=CCC=CCC=CCCCC(O)=O | Source: | widespread in animal tissue | Therapeutics: | prostaglandin & leucotriene precursor, stimulates NO biosynthesis | Generic_name: | ARACHIDONIC ACID | Chemical_iupac_name: | ARACHIDONIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00219 | Drugbank_id: | EXPT00409 | Logp: | 4.881 | Cas_registry_number: | 506-32-1 | Drug_category: | Prostaglandin H2 Synthase-1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
LAT1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5741±0.022981 |
Normalized OD Score: sc h |
0.8569±0.0375173 |
Z-Score: |
-6.9902±1.39775 |
p-Value: |
0.000000000975672 |
Z-Factor: |
-0.16724 |
Fitness Defect: |
20.7479 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|G5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.40 Celcius | Date: | 2008-04-23 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00112 | Plate DMSO Control (-): | 0.651275±0.01133 | Plate Z-Factor: | 0.9468 |
| png ps pdf |
6440225 |
(5E,11E,14E)-icosa-5,11,14-trienoic acid |
11075089 |
(5Z,8Z)-11-deuteriotetradeca-5,8-dienoic acid |
16036708 |
calcium (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 8909 | Additional Members: 3 | Rows returned: 0 | |
|