| Compound Information | SONAR Target prediction | | Name: | ARACHIDONIC ACID | | Unique Identifier: | SPE01504138 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 272.213 g/mol | | X log p: | 15.756 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 14 | | Canonical Smiles: | CCCCCC=CCC=CCC=CCC=CCCCC(O)=O | | Source: | widespread in animal tissue | | Therapeutics: | prostaglandin & leucotriene precursor, stimulates NO biosynthesis | | Generic_name: | ARACHIDONIC ACID | | Chemical_iupac_name: | ARACHIDONIC ACID | | Drug_type: | Experimental | | Kegg_compound_id: | C00219 | | Drugbank_id: | EXPT00409 | | Logp: | 4.881 | | Cas_registry_number: | 506-32-1 | | Drug_category: | Prostaglandin H2 Synthase-1 inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
DRS2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5888±0.0236881 |
| Normalized OD Score: sc h |
0.8312±0.0226861 |
| Z-Score: |
-7.2849±0.961839 |
| p-Value: |
0.0000000000199112 |
| Z-Factor: |
0.177869 |
| Fitness Defect: |
24.6397 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 24|G5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.90 Celcius | | Date: | 2008-01-11 YYYY-MM-DD | | Plate CH Control (+): | 0.041550000000000004±0.00074 | | Plate DMSO Control (-): | 0.6819249999999999±0.01599 | | Plate Z-Factor: | 0.9190 |
|  png
ps
pdf |
| 5462112 |
(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoic acid |
| 6437826 |
sodium (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
| 6439516 |
(5E,8E,14E)-icosa-5,8,14-trienoic acid |
| 6439528 |
(5E,8E,11E,14E)-19-hydroxyicosa-5,8,11,14-tetraenoic acid |
| 6439722 |
(5E,8E,11E,14E)-10,10-dimethylicosa-5,8,11,14-tetraenoic acid |
| 6440150 |
(5E,8E,11E,14E)-7,7-dimethylicosa-5,8,11,14-tetraenoic acid |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 8909 | Additional Members: 3 | Rows returned: 0 | |
|
