Compound Information | SONAR Target prediction | Name: | ARACHIDONIC ACID | Unique Identifier: | SPE01504138 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 272.213 g/mol | X log p: | 15.756 (online calculus) | Lipinksi Failures | 2 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 14 | Canonical Smiles: | CCCCCC=CCC=CCC=CCC=CCCCC(O)=O | Source: | widespread in animal tissue | Therapeutics: | prostaglandin & leucotriene precursor, stimulates NO biosynthesis | Generic_name: | ARACHIDONIC ACID | Chemical_iupac_name: | ARACHIDONIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00219 | Drugbank_id: | EXPT00409 | Logp: | 4.881 | Cas_registry_number: | 506-32-1 | Drug_category: | Prostaglandin H2 Synthase-1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.4215±0.0145664 |
Normalized OD Score: sc h |
0.8559±0.00472291 |
Z-Score: |
-4.0353±0.13799 |
p-Value: |
0.0000590356 |
Z-Factor: |
0.307253 |
Fitness Defect: |
9.7374 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|G5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.10 Celcius | Date: | 2008-06-05 YYYY-MM-DD | Plate CH Control (+): | 0.041025000000000006±0.00284 | Plate DMSO Control (-): | 0.48297500000000004±0.01395 | Plate Z-Factor: | 0.8748 |
| png ps pdf |
5312409 |
(5E,8E)-tetradeca-5,8-dienoic acid |
5312541 |
(5E,11E,14E,17E)-icosa-5,11,14,17-tetraenoic acid |
5312542 |
(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoic acid |
5312543 |
(5E,11E,14E,17E)-icosa-5,11,14,17-tetraenoic acid |
5460265 |
(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
5462110 |
(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoic acid |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 8909 | Additional Members: 3 | Rows returned: 0 | |
|